C18H25F3O4 — CID 91732381
4-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-(1,1,1-trifluoropropan-2-yl) butanedioate (PubChem CID 91732381) has the molecular formula C18H25F3O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-(1,1,1-trifluoropropan-2-yl) butanedioate.
| Compound Name | 4-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-(1,1,1-trifluoropropan-2-yl) butanedioate |
|---|---|
| PubChem CID | 91732381 |
| Molecular Formula | C18H25F3O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 4-O-(2,6-dimethylnon-1-en-3-yn-5-yl) 1-O-(1,1,1-trifluoropropan-2-yl) butanedioate |
| SMILES | C=C(C)C#CC(OC(=O)CCC(=O)OC(C)C(F)(F)F)C(C)CCC |
| InChI | InChI=1S/C18H25F3O4/c1-6-7-13(4)15(9-8-12(2)3)25-17(23)11-10-16(22)24-14(5)18(19,20)21/h13-15H,2,6-7,10-11H2,1,3-5H3 |
| InChIKey | SBKKZCMYUZLGFC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|