C10H17F3O4 — CID 168734514
2-[2,2-difluoro-2-(fluoromethoxy)ethoxy]ethyl 2-methylbutanoate (PubChem CID 168734514) has the molecular formula C10H17F3O4 and a molecular weight of 258.24 g/mol. Its IUPAC name is 2-[2,2-difluoro-2-(fluoromethoxy)ethoxy]ethyl 2-methylbutanoate.
| Compound Name | 2-[2,2-difluoro-2-(fluoromethoxy)ethoxy]ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 168734514 |
| Molecular Formula | C10H17F3O4 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-[2,2-difluoro-2-(fluoromethoxy)ethoxy]ethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCOCC(F)(F)OCF |
| InChI | InChI=1S/C10H17F3O4/c1-3-8(2)9(14)16-5-4-15-6-10(12,13)17-7-11/h8H,3-7H2,1-2H3 |
| InChIKey | IYQPKHLVRUSFFB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|