C29H54O14 — CID 170008807
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,3-dioxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylbutanoate (PubChem CID 170008807) has the molecular formula C29H54O14 and a molecular weight of 626.74 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,3-dioxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylbutanoate.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,3-dioxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 170008807 |
| Molecular Formula | C29H54O14 |
| Molecular Weight | 626.74 g/mol |
| Exact Mass | 626.35 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2,3-dioxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCC(=O)C(C)=O |
| InChI | InChI=1S/C29H54O14/c1-4-26(2)29(32)43-24-23-41-20-19-39-16-15-37-12-11-35-8-7-33-5-6-34-9-10-36-13-14-38-17-18-40-21-22-42-25-28(31)27(3)30/h26H,4-25H2,1-3H3 |
| InChIKey | DLWSIDHDBCVFSC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 152.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.74 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|