C27H50O9 — CID 131979541
2-[2,2-bis[2-(2-methylbutanoyloxy)ethoxymethyl]butoxy]ethyl 2-methylbutanoate (PubChem CID 131979541) has the molecular formula C27H50O9 and a molecular weight of 518.69 g/mol. Its IUPAC name is 2-[2,2-bis[2-(2-methylbutanoyloxy)ethoxymethyl]butoxy]ethyl 2-methylbutanoate.
| Compound Name | 2-[2,2-bis[2-(2-methylbutanoyloxy)ethoxymethyl]butoxy]ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 131979541 |
| Molecular Formula | C27H50O9 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.35 |
| IUPAC Name | 2-[2,2-bis[2-(2-methylbutanoyloxy)ethoxymethyl]butoxy]ethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCOCC(CC)(COCCOC(=O)C(C)CC)COCCOC(=O)C(C)CC |
| InChI | InChI=1S/C27H50O9/c1-8-21(5)24(28)34-15-12-31-18-27(11-4,19-32-13-16-35-25(29)22(6)9-2)20-33-14-17-36-26(30)23(7)10-3/h21-23H,8-20H2,1-7H3 |
| InChIKey | FFPURRRDWCOPJX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|