C11H15F5O5 — CID 168734523
2-[2,3,3,3-tetrafluoro-2-(fluoromethoxy)propanoyl]oxyethyl 2-methylbutanoate (PubChem CID 168734523) has the molecular formula C11H15F5O5 and a molecular weight of 322.23 g/mol. Its IUPAC name is 2-[2,3,3,3-tetrafluoro-2-(fluoromethoxy)propanoyl]oxyethyl 2-methylbutanoate.
| Compound Name | 2-[2,3,3,3-tetrafluoro-2-(fluoromethoxy)propanoyl]oxyethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 168734523 |
| Molecular Formula | C11H15F5O5 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-[2,3,3,3-tetrafluoro-2-(fluoromethoxy)propanoyl]oxyethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCOC(=O)C(F)(OCF)C(F)(F)F |
| InChI | InChI=1S/C11H15F5O5/c1-3-7(2)8(17)19-4-5-20-9(18)10(13,21-6-12)11(14,15)16/h7H,3-6H2,1-2H3 |
| InChIKey | WEBAHBFVXMBCKW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|