C25H35F13O3 — CID 168856397
2-ethylhexyl 4-ethyl-9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluoro-2-methyl-5-oxotetradecanoate (PubChem CID 168856397) has the molecular formula C25H35F13O3 and a molecular weight of 630.53 g/mol. Its IUPAC name is 2-ethylhexyl 4-ethyl-9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluoro-2-methyl-5-oxotetradecanoate.
| Compound Name | 2-ethylhexyl 4-ethyl-9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluoro-2-methyl-5-oxotetradecanoate |
|---|---|
| PubChem CID | 168856397 |
| Molecular Formula | C25H35F13O3 |
| Molecular Weight | 630.53 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | 2-ethylhexyl 4-ethyl-9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluoro-2-methyl-5-oxotetradecanoate |
| SMILES | CCCCC(CC)COC(=O)C(C)CC(CC)C(=O)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H35F13O3/c1-5-8-10-16(6-2)14-41-19(40)15(4)13-17(7-3)18(39)11-9-12-20(26,27)21(28,29)22(30,31)23(32,33)24(34,35)25(36,37)38/h15-17H,5-14H2,1-4H3 |
| InChIKey | FPHFEIBGSKCDFD-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.53 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|