About 1-O-(2-ethylhexyl) 5-O-(pyridin-4-ylmethyl) 4-ethyl-2-methylpentanedioate
1-O-(2-ethylhexyl) 5-O-(pyridin-4-ylmethyl) 4-ethyl-2-methylpentanedioate (PubChem CID 168856391) has the molecular formula C22H35NO4
and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-O-(2-ethylhexyl) 5-O-(pyridin-4-ylmethyl) 4-ethyl-2-methylpentanedioate.
Molecular Properties
| Compound Name | 1-O-(2-ethylhexyl) 5-O-(pyridin-4-ylmethyl) 4-ethyl-2-methylpentanedioate |
| PubChem CID | 168856391 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 1-O-(2-ethylhexyl) 5-O-(pyridin-4-ylmethyl) 4-ethyl-2-methylpentanedioate |
| SMILES | CCCCC(CC)COC(=O)C(C)CC(CC)C(=O)OCc1ccncc1 |
| InChI | InChI=1S/C22H35NO4/c1-5-8-9-18(6-2)15-26-21(24)17(4)14-20(7-3)22(25)27-16-19-10-12-23-13-11-19/h10-13,17-18,20H,5-9,14-16H2,1-4H3 |
| InChIKey | YOZQJNCKJUMSML-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-O-(2-ethylhexyl) 5-O-(pyridin-4-ylmethyl) 4-ethyl-2-methylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2-ethylhexyl) 5-O-(pyridin-4-ylmethyl) 4-ethyl-2-methylpentanedioate?
The IUPAC name of 1-O-(2-ethylhexyl) 5-O-(pyridin-4-ylmethyl) 4-ethyl-2-methylpentanedioate (CID 168856391) is 1-O-(2-ethylhexyl) 5-O-(pyridin-4-ylmethyl) 4-ethyl-2-methylpentanedioate.
What is the SMILES notation for 1-O-(2-ethylhexyl) 5-O-(pyridin-4-ylmethyl) 4-ethyl-2-methylpentanedioate?
The canonical SMILES for 1-O-(2-ethylhexyl) 5-O-(pyridin-4-ylmethyl) 4-ethyl-2-methylpentanedioate is CCCCC(CC)COC(=O)C(C)CC(CC)C(=O)OCc1ccncc1.
What is the InChIKey of 1-O-(2-ethylhexyl) 5-O-(pyridin-4-ylmethyl) 4-ethyl-2-methylpentanedioate?
The InChIKey is YOZQJNCKJUMSML-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35NO4/c1-5-8-9-18(6-2)15-26-21(24)17(4)14-20(7-3)22(25)27-16-19-10-12-23-13-11-19/h10-13,17-18,20H,5-9,14-16H2,1-4H3.
What are the key properties of 1-O-(2-ethylhexyl) 5-O-(pyridin-4-ylmethyl) 4-ethyl-2-methylpentanedioate?
1-O-(2-ethylhexyl) 5-O-(pyridin-4-ylmethyl) 4-ethyl-2-methylpentanedioate has a molecular weight of 377.53 g/mol, XLogP of 4.94, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2-ethylhexyl) 5-O-(pyridin-4-ylmethyl) 4-ethyl-2-methylpentanedioate is sourced from PubChem (CID 168856391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).