C29H40O4 — CID 141413388
bis[(4-propylphenyl)methyl] 2,4-diethylpentanedioate (PubChem CID 141413388) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is bis[(4-propylphenyl)methyl] 2,4-diethylpentanedioate.
| Compound Name | bis[(4-propylphenyl)methyl] 2,4-diethylpentanedioate |
|---|---|
| PubChem CID | 141413388 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | bis[(4-propylphenyl)methyl] 2,4-diethylpentanedioate |
| SMILES | CCCc1ccc(COC(=O)C(CC)CC(CC)C(=O)OCc2ccc(CCC)cc2)cc1 |
| InChI | InChI=1S/C29H40O4/c1-5-9-22-11-15-24(16-12-22)20-32-28(30)26(7-3)19-27(8-4)29(31)33-21-25-17-13-23(10-6-2)14-18-25/h11-18,26-27H,5-10,19-21H2,1-4H3 |
| InChIKey | XQEPOBKSMDTEOW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |