C18H32NO5- — CID 23528127
7-butoxy-2-ethyl-6-methyl-7-oxo-4-(propan-2-ylcarbamoyl)heptanoate (PubChem CID 23528127) has the molecular formula C18H32NO5- and a molecular weight of 342.46 g/mol. Its IUPAC name is 7-butoxy-2-ethyl-6-methyl-7-oxo-4-(propan-2-ylcarbamoyl)heptanoate.
| Compound Name | 7-butoxy-2-ethyl-6-methyl-7-oxo-4-(propan-2-ylcarbamoyl)heptanoate |
|---|---|
| PubChem CID | 23528127 |
| Molecular Formula | C18H32NO5- |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 7-butoxy-2-ethyl-6-methyl-7-oxo-4-(propan-2-ylcarbamoyl)heptanoate |
| SMILES | CCCCOC(=O)C(C)CC(CC(CC)C(=O)[O-])C(=O)NC(C)C |
| InChI | InChI=1S/C18H33NO5/c1-6-8-9-24-18(23)13(5)10-15(16(20)19-12(3)4)11-14(7-2)17(21)22/h12-15H,6-11H2,1-5H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | XTMHFZWHRCDZGV-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|