C5H7Li2NO6S — CID 23542740
dilithium;2-acetamido-3-sulfonatopropanoate (PubChem CID 23542740) has the molecular formula C5H7Li2NO6S and a molecular weight of 223.06 g/mol. Its IUPAC name is dilithium;2-acetamido-3-sulfonatopropanoate.
| Compound Name | dilithium;2-acetamido-3-sulfonatopropanoate |
|---|---|
| PubChem CID | 23542740 |
| Molecular Formula | C5H7Li2NO6S |
| Molecular Weight | 223.06 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | dilithium;2-acetamido-3-sulfonatopropanoate |
| SMILES | CC(=O)NC(CS(=O)(=O)[O-])C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C5H9NO6S.2Li/c1-3(7)6-4(5(8)9)2-13(10,11)12;;/h4H,2H2,1H3,(H,6,7)(H,8,9)(H,10,11,12);;/q;2*+1/p-2 |
| InChIKey | NZOAMRALUJZTSC-UHFFFAOYSA-L |
| XLogP | -9.21 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.06 |
| LogP ≤ 5 | -9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|