About 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide
2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide (PubChem CID 91573505) has the molecular formula C10H22N2O3
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide |
| PubChem CID | 91573505 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide |
| SMILES | CNC(=O)C(NC(O)CC(C)O)C(C)C |
| InChI | InChI=1S/C10H22N2O3/c1-6(2)9(10(15)11-4)12-8(14)5-7(3)13/h6-9,12-14H,5H2,1-4H3,(H,11,15) |
| InChIKey | BOGIFKJFPIATRJ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide?
The IUPAC name of 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide (CID 91573505) is 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide.
What is the SMILES notation for 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide?
The canonical SMILES for 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide is CNC(=O)C(NC(O)CC(C)O)C(C)C.
What is the InChIKey of 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide?
The InChIKey is BOGIFKJFPIATRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O3/c1-6(2)9(10(15)11-4)12-8(14)5-7(3)13/h6-9,12-14H,5H2,1-4H3,(H,11,15).
What are the key properties of 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide?
2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide has a molecular weight of 218.30 g/mol, XLogP of -0.56, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide is sourced from PubChem (CID 91573505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).