C10H22N2O3 — CID 91573505
2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide (PubChem CID 91573505) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide.
| Compound Name | 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 91573505 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 2-(1,3-dihydroxybutylamino)-N,3-dimethylbutanamide |
| SMILES | CNC(=O)C(NC(O)CC(C)O)C(C)C |
| InChI | InChI=1S/C10H22N2O3/c1-6(2)9(10(15)11-4)12-8(14)5-7(3)13/h6-9,12-14H,5H2,1-4H3,(H,11,15) |
| InChIKey | BOGIFKJFPIATRJ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|