C15H23N3O — CID 87164646
(2S)-3-methyl-2-[[(2S,3S)-3-methylaziridin-2-yl]methylamino]-N-phenylbutanamide (PubChem CID 87164646) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[(2S,3S)-3-methylaziridin-2-yl]methylamino]-N-phenylbutanamide.
| Compound Name | (2S)-3-methyl-2-[[(2S,3S)-3-methylaziridin-2-yl]methylamino]-N-phenylbutanamide |
|---|---|
| PubChem CID | 87164646 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | (2S)-3-methyl-2-[[(2S,3S)-3-methylaziridin-2-yl]methylamino]-N-phenylbutanamide |
| SMILES | CC(C)[C@H](NC[C@@H]1N[C@H]1C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H23N3O/c1-10(2)14(16-9-13-11(3)17-13)15(19)18-12-7-5-4-6-8-12/h4-8,10-11,13-14,16-17H,9H2,1-3H3,(H,18,19)/t11-,13-,14-/m0/s1 |
| InChIKey | SQECROZAGPNLAE-UBHSHLNASA-N |
| XLogP | 1.60 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|