C20H25N3O — CID 25002044
3-methyl-N-phenyl-2-[(3-phenylaziridin-2-yl)methylamino]butanamide (PubChem CID 25002044) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-methyl-N-phenyl-2-[(3-phenylaziridin-2-yl)methylamino]butanamide.
| Compound Name | 3-methyl-N-phenyl-2-[(3-phenylaziridin-2-yl)methylamino]butanamide |
|---|---|
| PubChem CID | 25002044 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 3-methyl-N-phenyl-2-[(3-phenylaziridin-2-yl)methylamino]butanamide |
| SMILES | CC(C)C(NCC1NC1c1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H25N3O/c1-14(2)18(20(24)22-16-11-7-4-8-12-16)21-13-17-19(23-17)15-9-5-3-6-10-15/h3-12,14,17-19,21,23H,13H2,1-2H3,(H,22,24) |
| InChIKey | KCTHMYRKCDNOAO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|