C21H37N3O2Si — CID 24997287
(2S)-2-[[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]aziridin-2-yl]methylamino]-3-methyl-N-phenylbutanamide (PubChem CID 24997287) has the molecular formula C21H37N3O2Si and a molecular weight of 391.63 g/mol. Its IUPAC name is (2S)-2-[[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]aziridin-2-yl]methylamino]-3-methyl-N-phenylbutanamide.
| Compound Name | (2S)-2-[[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]aziridin-2-yl]methylamino]-3-methyl-N-phenylbutanamide |
|---|---|
| PubChem CID | 24997287 |
| Molecular Formula | C21H37N3O2Si |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | (2S)-2-[[(2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]aziridin-2-yl]methylamino]-3-methyl-N-phenylbutanamide |
| SMILES | CC(C)[C@H](NC[C@H]1N[C@H]1CO[Si](C)(C)C(C)(C)C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H37N3O2Si/c1-15(2)19(20(25)23-16-11-9-8-10-12-16)22-13-17-18(24-17)14-26-27(6,7)21(3,4)5/h8-12,15,17-19,22,24H,13-14H2,1-7H3,(H,23,25)/t17-,18+,19+/m1/s1 |
| InChIKey | GLNUGKUVTSHWAQ-QYZOEREBSA-N |
| XLogP | 3.60 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|