C10H17N3O2 — CID 108811952
3-(1,2-oxazol-3-yl)-1,1-dipropylurea (PubChem CID 108811952) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-(1,2-oxazol-3-yl)-1,1-dipropylurea.
| Compound Name | 3-(1,2-oxazol-3-yl)-1,1-dipropylurea |
|---|---|
| PubChem CID | 108811952 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-(1,2-oxazol-3-yl)-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)Nc1ccon1 |
| InChI | InChI=1S/C10H17N3O2/c1-3-6-13(7-4-2)10(14)11-9-5-8-15-12-9/h5,8H,3-4,6-7H2,1-2H3,(H,11,12,14) |
| InChIKey | BWQPNXWLMBVUSV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |