C8H11N3O2 — CID 130684719
1-methyl-3-(1,2-oxazol-3-yl)-1-prop-2-enylurea (PubChem CID 130684719) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 1-methyl-3-(1,2-oxazol-3-yl)-1-prop-2-enylurea.
| Compound Name | 1-methyl-3-(1,2-oxazol-3-yl)-1-prop-2-enylurea |
|---|---|
| PubChem CID | 130684719 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 1-methyl-3-(1,2-oxazol-3-yl)-1-prop-2-enylurea |
| SMILES | C=CCN(C)C(=O)Nc1ccon1 |
| InChI | InChI=1S/C8H11N3O2/c1-3-5-11(2)8(12)9-7-4-6-13-10-7/h3-4,6H,1,5H2,2H3,(H,9,10,12) |
| InChIKey | DBXHVIXVCMXOQE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|