C16H14F3N3O3 — CID 42769078
N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-prop-2-enyl-4-(trifluoromethyl)benzamide (PubChem CID 42769078) has the molecular formula C16H14F3N3O3 and a molecular weight of 353.30 g/mol. Its IUPAC name is N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-prop-2-enyl-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-prop-2-enyl-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 42769078 |
| Molecular Formula | C16H14F3N3O3 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-prop-2-enyl-4-(trifluoromethyl)benzamide |
| SMILES | C=CCN(CC(=O)Nc1ccon1)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F3N3O3/c1-2-8-22(10-14(23)20-13-7-9-25-21-13)15(24)11-3-5-12(6-4-11)16(17,18)19/h2-7,9H,1,8,10H2,(H,20,21,23) |
| InChIKey | SOHLWXKFUROGOJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|