C18H21N3O3 — CID 3332397
N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-2-phenyl-N-prop-2-enylbutanamide (PubChem CID 3332397) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-2-phenyl-N-prop-2-enylbutanamide.
| Compound Name | N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-2-phenyl-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 3332397 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-2-phenyl-N-prop-2-enylbutanamide |
| SMILES | C=CCN(CC(=O)Nc1ccon1)C(=O)C(CC)c1ccccc1 |
| InChI | InChI=1S/C18H21N3O3/c1-3-11-21(13-17(22)19-16-10-12-24-20-16)18(23)15(4-2)14-8-6-5-7-9-14/h3,5-10,12,15H,1,4,11,13H2,2H3,(H,19,20,22) |
| InChIKey | PRRLHASKTTYGSS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|