C18H21N3O2S — CID 4995894
N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-2-phenyl-N-prop-2-enylbutanamide (PubChem CID 4995894) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-2-phenyl-N-prop-2-enylbutanamide.
| Compound Name | N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-2-phenyl-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 4995894 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-2-phenyl-N-prop-2-enylbutanamide |
| SMILES | C=CCN(CC(=O)Nc1nccs1)C(=O)C(CC)c1ccccc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-3-11-21(13-16(22)20-18-19-10-12-24-18)17(23)15(4-2)14-8-6-5-7-9-14/h3,5-10,12,15H,1,4,11,13H2,2H3,(H,19,20,22) |
| InChIKey | WAQVRCNQQJKGAH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|