C22H23N3O3 — CID 42769030
N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-2,2-diphenyl-N-propylacetamide (PubChem CID 42769030) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-2,2-diphenyl-N-propylacetamide.
| Compound Name | N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-2,2-diphenyl-N-propylacetamide |
|---|---|
| PubChem CID | 42769030 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-2,2-diphenyl-N-propylacetamide |
| SMILES | CCCN(CC(=O)Nc1ccon1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O3/c1-2-14-25(16-20(26)23-19-13-15-28-24-19)22(27)21(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-13,15,21H,2,14,16H2,1H3,(H,23,24,26) |
| InChIKey | QFTVTLWPWGQIPY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |