C16H19N3O3 — CID 5085996
N-butan-2-yl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide (PubChem CID 5085996) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-butan-2-yl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide.
| Compound Name | N-butan-2-yl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 5085996 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-butan-2-yl-N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]benzamide |
| SMILES | CCC(C)N(CC(=O)Nc1ccon1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H19N3O3/c1-3-12(2)19(16(21)13-7-5-4-6-8-13)11-15(20)17-14-9-10-22-18-14/h4-10,12H,3,11H2,1-2H3,(H,17,18,20) |
| InChIKey | WHEXWWWGMNBJIE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |