C28H23F3N4O2 — CID 46146230
N-[2-oxo-2-[[4-phenyl-1-[4-(trifluoromethyl)phenyl]imidazol-2-yl]amino]ethyl]-N-prop-2-enylbenzamide (PubChem CID 46146230) has the molecular formula C28H23F3N4O2 and a molecular weight of 504.51 g/mol. Its IUPAC name is N-[2-oxo-2-[[4-phenyl-1-[4-(trifluoromethyl)phenyl]imidazol-2-yl]amino]ethyl]-N-prop-2-enylbenzamide.
| Compound Name | N-[2-oxo-2-[[4-phenyl-1-[4-(trifluoromethyl)phenyl]imidazol-2-yl]amino]ethyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 46146230 |
| Molecular Formula | C28H23F3N4O2 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | N-[2-oxo-2-[[4-phenyl-1-[4-(trifluoromethyl)phenyl]imidazol-2-yl]amino]ethyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)Nc1nc(-c2ccccc2)cn1-c1ccc(C(F)(F)F)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C28H23F3N4O2/c1-2-17-34(26(37)21-11-7-4-8-12-21)19-25(36)33-27-32-24(20-9-5-3-6-10-20)18-35(27)23-15-13-22(14-16-23)28(29,30)31/h2-16,18H,1,17,19H2,(H,32,33,36) |
| InChIKey | RFTDMEYEJUUWFH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|