C28H25F3N4O4S — CID 42829865
2-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]-N-[4-phenyl-1-[4-(trifluoromethyl)phenyl]imidazol-2-yl]acetamide (PubChem CID 42829865) has the molecular formula C28H25F3N4O4S and a molecular weight of 570.59 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]-N-[4-phenyl-1-[4-(trifluoromethyl)phenyl]imidazol-2-yl]acetamide.
| Compound Name | 2-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]-N-[4-phenyl-1-[4-(trifluoromethyl)phenyl]imidazol-2-yl]acetamide |
|---|---|
| PubChem CID | 42829865 |
| Molecular Formula | C28H25F3N4O4S |
| Molecular Weight | 570.59 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 2-[(4-methoxyphenyl)sulfonyl-prop-2-enylamino]-N-[4-phenyl-1-[4-(trifluoromethyl)phenyl]imidazol-2-yl]acetamide |
| SMILES | C=CCN(CC(=O)Nc1nc(-c2ccccc2)cn1-c1ccc(C(F)(F)F)cc1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H25F3N4O4S/c1-3-17-34(40(37,38)24-15-13-23(39-2)14-16-24)19-26(36)33-27-32-25(20-7-5-4-6-8-20)18-35(27)22-11-9-21(10-12-22)28(29,30)31/h3-16,18H,1,17,19H2,2H3,(H,32,33,36) |
| InChIKey | JEPXFCGXTAZGLI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|