C28H24ClFN4O2 — CID 42828464
N-[2-[[4-(4-chlorophenyl)-1-(3-methylphenyl)imidazol-2-yl]amino]-2-oxoethyl]-2-fluoro-N-prop-2-enylbenzamide (PubChem CID 42828464) has the molecular formula C28H24ClFN4O2 and a molecular weight of 502.98 g/mol. Its IUPAC name is N-[2-[[4-(4-chlorophenyl)-1-(3-methylphenyl)imidazol-2-yl]amino]-2-oxoethyl]-2-fluoro-N-prop-2-enylbenzamide.
| Compound Name | N-[2-[[4-(4-chlorophenyl)-1-(3-methylphenyl)imidazol-2-yl]amino]-2-oxoethyl]-2-fluoro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 42828464 |
| Molecular Formula | C28H24ClFN4O2 |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | N-[2-[[4-(4-chlorophenyl)-1-(3-methylphenyl)imidazol-2-yl]amino]-2-oxoethyl]-2-fluoro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)Nc1nc(-c2ccc(Cl)cc2)cn1-c1cccc(C)c1)C(=O)c1ccccc1F |
| InChI | InChI=1S/C28H24ClFN4O2/c1-3-15-33(27(36)23-9-4-5-10-24(23)30)18-26(35)32-28-31-25(20-11-13-21(29)14-12-20)17-34(28)22-8-6-7-19(2)16-22/h3-14,16-17H,1,15,18H2,2H3,(H,31,32,35) |
| InChIKey | RJQAETHHOOSRJO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|