C24H26ClN5O3 — CID 42828613
N-[4-(4-chlorophenyl)-1-(3-methoxyphenyl)imidazol-2-yl]-2-[ethylcarbamoyl(prop-2-enyl)amino]acetamide (PubChem CID 42828613) has the molecular formula C24H26ClN5O3 and a molecular weight of 467.96 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1-(3-methoxyphenyl)imidazol-2-yl]-2-[ethylcarbamoyl(prop-2-enyl)amino]acetamide.
| Compound Name | N-[4-(4-chlorophenyl)-1-(3-methoxyphenyl)imidazol-2-yl]-2-[ethylcarbamoyl(prop-2-enyl)amino]acetamide |
|---|---|
| PubChem CID | 42828613 |
| Molecular Formula | C24H26ClN5O3 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1-(3-methoxyphenyl)imidazol-2-yl]-2-[ethylcarbamoyl(prop-2-enyl)amino]acetamide |
| SMILES | C=CCN(CC(=O)Nc1nc(-c2ccc(Cl)cc2)cn1-c1cccc(OC)c1)C(=O)NCC |
| InChI | InChI=1S/C24H26ClN5O3/c1-4-13-29(24(32)26-5-2)16-22(31)28-23-27-21(17-9-11-18(25)12-10-17)15-30(23)19-7-6-8-20(14-19)33-3/h4,6-12,14-15H,1,5,13,16H2,2-3H3,(H,26,32)(H,27,28,31) |
| InChIKey | CFMDWMVPLAIVFP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|