C9H15N3O2 — CID 42656286
2-(butan-2-ylamino)-N-(1,2-oxazol-3-yl)acetamide (PubChem CID 42656286) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-N-(1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-(butan-2-ylamino)-N-(1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 42656286 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-(butan-2-ylamino)-N-(1,2-oxazol-3-yl)acetamide |
| SMILES | CCC(C)NCC(=O)Nc1ccon1 |
| InChI | InChI=1S/C9H15N3O2/c1-3-7(2)10-6-9(13)11-8-4-5-14-12-8/h4-5,7,10H,3,6H2,1-2H3,(H,11,12,13) |
| InChIKey | CSQAXYYSQUVCGE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |