C6H8N2O2 — CID 134365641
1-(1,2-oxazol-3-ylamino)propan-2-one (PubChem CID 134365641) has the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. Its IUPAC name is 1-(1,2-oxazol-3-ylamino)propan-2-one.
| Compound Name | 1-(1,2-oxazol-3-ylamino)propan-2-one |
|---|---|
| PubChem CID | 134365641 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 1-(1,2-oxazol-3-ylamino)propan-2-one |
| SMILES | CC(=O)CNc1ccon1 |
| InChI | InChI=1S/C6H8N2O2/c1-5(9)4-7-6-2-3-10-8-6/h2-3H,4H2,1H3,(H,7,8) |
| InChIKey | HPDGSRKULWFRNE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |