C14H13F2N3O2 — CID 47032147
1-(2,6-difluorophenyl)-3-[(2-methoxy-4-pyridinyl)methyl]urea (PubChem CID 47032147) has the molecular formula C14H13F2N3O2 and a molecular weight of 293.27 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[(2-methoxy-4-pyridinyl)methyl]urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[(2-methoxy-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 47032147 |
| Molecular Formula | C14H13F2N3O2 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[(2-methoxy-4-pyridinyl)methyl]urea |
| SMILES | COc1cc(CNC(=O)Nc2c(F)cccc2F)ccn1 |
| InChI | InChI=1S/C14H13F2N3O2/c1-21-12-7-9(5-6-17-12)8-18-14(20)19-13-10(15)3-2-4-11(13)16/h2-7H,8H2,1H3,(H2,18,19,20) |
| InChIKey | JDYOYZWVJZTCRE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |