C15H16BrN3O2 — CID 55696398
1-(2-bromo-4-methylphenyl)-3-[(2-methoxy-4-pyridinyl)methyl]urea (PubChem CID 55696398) has the molecular formula C15H16BrN3O2 and a molecular weight of 350.22 g/mol. Its IUPAC name is 1-(2-bromo-4-methylphenyl)-3-[(2-methoxy-4-pyridinyl)methyl]urea.
| Compound Name | 1-(2-bromo-4-methylphenyl)-3-[(2-methoxy-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 55696398 |
| Molecular Formula | C15H16BrN3O2 |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 1-(2-bromo-4-methylphenyl)-3-[(2-methoxy-4-pyridinyl)methyl]urea |
| SMILES | COc1cc(CNC(=O)Nc2ccc(C)cc2Br)ccn1 |
| InChI | InChI=1S/C15H16BrN3O2/c1-10-3-4-13(12(16)7-10)19-15(20)18-9-11-5-6-17-14(8-11)21-2/h3-8H,9H2,1-2H3,(H2,18,19,20) |
| InChIKey | FCLUJEBRGQHKEM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |