C18H14F2N4O — CID 121165562
1-(2,6-difluorophenyl)-3-[(2-pyridin-4-yl-4-pyridinyl)methyl]urea (PubChem CID 121165562) has the molecular formula C18H14F2N4O and a molecular weight of 340.33 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[(2-pyridin-4-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[(2-pyridin-4-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 121165562 |
| Molecular Formula | C18H14F2N4O |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[(2-pyridin-4-yl-4-pyridinyl)methyl]urea |
| SMILES | O=C(NCc1ccnc(-c2ccncc2)c1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C18H14F2N4O/c19-14-2-1-3-15(20)17(14)24-18(25)23-11-12-4-9-22-16(10-12)13-5-7-21-8-6-13/h1-10H,11H2,(H2,23,24,25) |
| InChIKey | SMIKFXIVKHSQPZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |