C14H18F2N2O3 — CID 111618724
1-[[3-(difluoromethoxy)phenyl]methyl]-3-[[1-(hydroxymethyl)cyclopropyl]methyl]urea (PubChem CID 111618724) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.30 g/mol. Its IUPAC name is 1-[[3-(difluoromethoxy)phenyl]methyl]-3-[[1-(hydroxymethyl)cyclopropyl]methyl]urea.
| Compound Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-3-[[1-(hydroxymethyl)cyclopropyl]methyl]urea |
|---|---|
| PubChem CID | 111618724 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-3-[[1-(hydroxymethyl)cyclopropyl]methyl]urea |
| SMILES | O=C(NCc1cccc(OC(F)F)c1)NCC1(CO)CC1 |
| InChI | InChI=1S/C14H18F2N2O3/c15-12(16)21-11-3-1-2-10(6-11)7-17-13(20)18-8-14(9-19)4-5-14/h1-3,6,12,19H,4-5,7-9H2,(H2,17,18,20) |
| InChIKey | IVEMWXMGWUPNTM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |