C17H20F2N2O2 — CID 22932395
1-(1-adamantyl)-3-(3,5-difluoro-4-hydroxyphenyl)urea (PubChem CID 22932395) has the molecular formula C17H20F2N2O2 and a molecular weight of 322.36 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-(3,5-difluoro-4-hydroxyphenyl)urea.
| Compound Name | 1-(1-adamantyl)-3-(3,5-difluoro-4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 22932395 |
| Molecular Formula | C17H20F2N2O2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-(1-adamantyl)-3-(3,5-difluoro-4-hydroxyphenyl)urea |
| SMILES | O=C(Nc1cc(F)c(O)c(F)c1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H20F2N2O2/c18-13-4-12(5-14(19)15(13)22)20-16(23)21-17-6-9-1-10(7-17)3-11(2-9)8-17/h4-5,9-11,22H,1-3,6-8H2,(H2,20,21,23) |
| InChIKey | AJZABJVKDXPOQI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|