C21H30N2O3 — CID 108896002
1-(1-adamantyl)-3-(3,4-diethoxyphenyl)urea (PubChem CID 108896002) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-(3,4-diethoxyphenyl)urea.
| Compound Name | 1-(1-adamantyl)-3-(3,4-diethoxyphenyl)urea |
|---|---|
| PubChem CID | 108896002 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 1-(1-adamantyl)-3-(3,4-diethoxyphenyl)urea |
| SMILES | CCOc1ccc(NC(=O)NC23CC4CC(CC(C4)C2)C3)cc1OCC |
| InChI | InChI=1S/C21H30N2O3/c1-3-25-18-6-5-17(10-19(18)26-4-2)22-20(24)23-21-11-14-7-15(12-21)9-16(8-14)13-21/h5-6,10,14-16H,3-4,7-9,11-13H2,1-2H3,(H2,22,23,24) |
| InChIKey | OTFKCVCYSJXQSY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |