C18H23BrN2O — CID 108896079
1-(1-adamantyl)-3-(4-bromo-3-methylphenyl)urea (PubChem CID 108896079) has the molecular formula C18H23BrN2O and a molecular weight of 363.30 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-(4-bromo-3-methylphenyl)urea.
| Compound Name | 1-(1-adamantyl)-3-(4-bromo-3-methylphenyl)urea |
|---|---|
| PubChem CID | 108896079 |
| Molecular Formula | C18H23BrN2O |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-(1-adamantyl)-3-(4-bromo-3-methylphenyl)urea |
| SMILES | Cc1cc(NC(=O)NC23CC4CC(CC(C4)C2)C3)ccc1Br |
| InChI | InChI=1S/C18H23BrN2O/c1-11-4-15(2-3-16(11)19)20-17(22)21-18-8-12-5-13(9-18)7-14(6-12)10-18/h2-4,12-14H,5-10H2,1H3,(H2,20,21,22) |
| InChIKey | BZEFCSPIUBBMOB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |