C19H26BrN2O+ — CID 7536745
1-adamantyl-[2-(4-bromo-3-methylanilino)-2-oxoethyl]azanium (PubChem CID 7536745) has the molecular formula C19H26BrN2O+ and a molecular weight of 378.33 g/mol. Its IUPAC name is 1-adamantyl-[2-(4-bromo-3-methylanilino)-2-oxoethyl]azanium.
| Compound Name | 1-adamantyl-[2-(4-bromo-3-methylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 7536745 |
| Molecular Formula | C19H26BrN2O+ |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1-adamantyl-[2-(4-bromo-3-methylanilino)-2-oxoethyl]azanium |
| SMILES | Cc1cc(NC(=O)C[NH2+]C23CC4CC(CC(C4)C2)C3)ccc1Br |
| InChI | InChI=1S/C19H25BrN2O/c1-12-4-16(2-3-17(12)20)22-18(23)11-21-19-8-13-5-14(9-19)7-15(6-13)10-19/h2-4,13-15,21H,5-11H2,1H3,(H,22,23)/p+1 |
| InChIKey | PWONQRJQMGJNLQ-UHFFFAOYSA-O |
| XLogP | 3.23 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |