C18H24N3O3+ — CID 9032282
1-adamantyl-[2-(3-nitroanilino)-2-oxoethyl]azanium (PubChem CID 9032282) has the molecular formula C18H24N3O3+ and a molecular weight of 330.41 g/mol. Its IUPAC name is 1-adamantyl-[2-(3-nitroanilino)-2-oxoethyl]azanium.
| Compound Name | 1-adamantyl-[2-(3-nitroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9032282 |
| Molecular Formula | C18H24N3O3+ |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-adamantyl-[2-(3-nitroanilino)-2-oxoethyl]azanium |
| SMILES | O=C(C[NH2+]C12CC3CC(CC(C3)C1)C2)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H23N3O3/c22-17(20-15-2-1-3-16(7-15)21(23)24)11-19-18-8-12-4-13(9-18)6-14(5-12)10-18/h1-3,7,12-14,19H,4-6,8-11H2,(H,20,22)/p+1 |
| InChIKey | RTEBBMJXWHQABT-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|