C21H27N3O2 — CID 5296041
1-(1-acetyl-2,3-dihydroindol-5-yl)-3-(1-adamantyl)urea (PubChem CID 5296041) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-(1-acetyl-2,3-dihydroindol-5-yl)-3-(1-adamantyl)urea.
| Compound Name | 1-(1-acetyl-2,3-dihydroindol-5-yl)-3-(1-adamantyl)urea |
|---|---|
| PubChem CID | 5296041 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-(1-acetyl-2,3-dihydroindol-5-yl)-3-(1-adamantyl)urea |
| SMILES | CC(=O)N1CCc2cc(NC(=O)NC34CC5CC(CC(C5)C3)C4)ccc21 |
| InChI | InChI=1S/C21H27N3O2/c1-13(25)24-5-4-17-9-18(2-3-19(17)24)22-20(26)23-21-10-14-6-15(11-21)8-16(7-14)12-21/h2-3,9,14-16H,4-8,10-12H2,1H3,(H2,22,23,26) |
| InChIKey | CEKXESSRBAUJTK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |