C19H23F2N3O2 — CID 112799804
N-(1-adamantylcarbamoyl)-2-(3,4-difluoroanilino)acetamide (PubChem CID 112799804) has the molecular formula C19H23F2N3O2 and a molecular weight of 363.41 g/mol. Its IUPAC name is N-(1-adamantylcarbamoyl)-2-(3,4-difluoroanilino)acetamide.
| Compound Name | N-(1-adamantylcarbamoyl)-2-(3,4-difluoroanilino)acetamide |
|---|---|
| PubChem CID | 112799804 |
| Molecular Formula | C19H23F2N3O2 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-(1-adamantylcarbamoyl)-2-(3,4-difluoroanilino)acetamide |
| SMILES | O=C(CNc1ccc(F)c(F)c1)NC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H23F2N3O2/c20-15-2-1-14(6-16(15)21)22-10-17(25)23-18(26)24-19-7-11-3-12(8-19)5-13(4-11)9-19/h1-2,6,11-13,22H,3-5,7-10H2,(H2,23,24,25,26) |
| InChIKey | GPKQIUIZCYDBQL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |