C14H17FN4O4 — CID 78795443
N-(cyclopentylcarbamoyl)-2-(4-fluoro-3-nitroanilino)acetamide (PubChem CID 78795443) has the molecular formula C14H17FN4O4 and a molecular weight of 324.31 g/mol. Its IUPAC name is N-(cyclopentylcarbamoyl)-2-(4-fluoro-3-nitroanilino)acetamide.
| Compound Name | N-(cyclopentylcarbamoyl)-2-(4-fluoro-3-nitroanilino)acetamide |
|---|---|
| PubChem CID | 78795443 |
| Molecular Formula | C14H17FN4O4 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-(cyclopentylcarbamoyl)-2-(4-fluoro-3-nitroanilino)acetamide |
| SMILES | O=C(CNc1ccc(F)c([N+](=O)[O-])c1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C14H17FN4O4/c15-11-6-5-10(7-12(11)19(22)23)16-8-13(20)18-14(21)17-9-3-1-2-4-9/h5-7,9,16H,1-4,8H2,(H2,17,18,20,21) |
| InChIKey | JIAWJOWSZVHRCF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|