C23H30FN3O4 — CID 4781462
[2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-(1-adamantylcarbamoylamino)propanoate (PubChem CID 4781462) has the molecular formula C23H30FN3O4 and a molecular weight of 431.51 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-(1-adamantylcarbamoylamino)propanoate.
| Compound Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-(1-adamantylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 4781462 |
| Molecular Formula | C23H30FN3O4 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-(1-adamantylcarbamoylamino)propanoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CCNC(=O)NC23CC4CC(CC(C4)C2)C3)cc1F |
| InChI | InChI=1S/C23H30FN3O4/c1-14-2-3-18(9-19(14)24)26-20(28)13-31-21(29)4-5-25-22(30)27-23-10-15-6-16(11-23)8-17(7-15)12-23/h2-3,9,15-17H,4-8,10-13H2,1H3,(H,26,28)(H2,25,27,30) |
| InChIKey | PBCSOGRIGMAMOC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |