C24H32N2O3 — CID 59168665
[4-(1-adamantylcarbamoylamino)cyclohexyl] benzoate (PubChem CID 59168665) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is [4-(1-adamantylcarbamoylamino)cyclohexyl] benzoate.
| Compound Name | [4-(1-adamantylcarbamoylamino)cyclohexyl] benzoate |
|---|---|
| PubChem CID | 59168665 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | [4-(1-adamantylcarbamoylamino)cyclohexyl] benzoate |
| SMILES | O=C(NC1CCC(OC(=O)c2ccccc2)CC1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H32N2O3/c27-22(19-4-2-1-3-5-19)29-21-8-6-20(7-9-21)25-23(28)26-24-13-16-10-17(14-24)12-18(11-16)15-24/h1-5,16-18,20-21H,6-15H2,(H2,25,26,28) |
| InChIKey | UJRZVCXNABEDEE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |