C26H44N2O4 — CID 11655301
ethyl 7-[4-(1-adamantylcarbamoylamino)cyclohexyl]oxyheptanoate (PubChem CID 11655301) has the molecular formula C26H44N2O4 and a molecular weight of 448.65 g/mol. Its IUPAC name is ethyl 7-[4-(1-adamantylcarbamoylamino)cyclohexyl]oxyheptanoate.
| Compound Name | ethyl 7-[4-(1-adamantylcarbamoylamino)cyclohexyl]oxyheptanoate |
|---|---|
| PubChem CID | 11655301 |
| Molecular Formula | C26H44N2O4 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | ethyl 7-[4-(1-adamantylcarbamoylamino)cyclohexyl]oxyheptanoate |
| SMILES | CCOC(=O)CCCCCCOC1CCC(NC(=O)NC23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C26H44N2O4/c1-2-31-24(29)7-5-3-4-6-12-32-23-10-8-22(9-11-23)27-25(30)28-26-16-19-13-20(17-26)15-21(14-19)18-26/h19-23H,2-18H2,1H3,(H2,27,28,30) |
| InChIKey | QISWMSGSTKLBBL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|