C19H18N4O4S — CID 52713596
4-(cyclopropylamino)-N-[4-(2,5-dimethylfuran-3-yl)-1,3-thiazol-2-yl]-3-nitrobenzamide (PubChem CID 52713596) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-[4-(2,5-dimethylfuran-3-yl)-1,3-thiazol-2-yl]-3-nitrobenzamide.
| Compound Name | 4-(cyclopropylamino)-N-[4-(2,5-dimethylfuran-3-yl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 52713596 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 4-(cyclopropylamino)-N-[4-(2,5-dimethylfuran-3-yl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
| SMILES | Cc1cc(-c2csc(NC(=O)c3ccc(NC4CC4)c([N+](=O)[O-])c3)n2)c(C)o1 |
| InChI | InChI=1S/C19H18N4O4S/c1-10-7-14(11(2)27-10)16-9-28-19(21-16)22-18(24)12-3-6-15(20-13-4-5-13)17(8-12)23(25)26/h3,6-9,13,20H,4-5H2,1-2H3,(H,21,22,24) |
| InChIKey | WIGCPLLOOUHVNN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|