C17H24ClN3O4 — CID 18162123
4-chloro-N-[3-methyl-1-(3-methylbutylamino)-1-oxobutan-2-yl]-3-nitrobenzamide (PubChem CID 18162123) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is 4-chloro-N-[3-methyl-1-(3-methylbutylamino)-1-oxobutan-2-yl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[3-methyl-1-(3-methylbutylamino)-1-oxobutan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 18162123 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-chloro-N-[3-methyl-1-(3-methylbutylamino)-1-oxobutan-2-yl]-3-nitrobenzamide |
| SMILES | CC(C)CCNC(=O)C(NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C17H24ClN3O4/c1-10(2)7-8-19-17(23)15(11(3)4)20-16(22)12-5-6-13(18)14(9-12)21(24)25/h5-6,9-11,15H,7-8H2,1-4H3,(H,19,23)(H,20,22) |
| InChIKey | CQCCKFSMYMECSQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|