C21H11BrN4O3S3 — CID 71592356
N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-2-(5-nitrothiophen-2-yl)quinoline-4-carboxamide (PubChem CID 71592356) has the molecular formula C21H11BrN4O3S3 and a molecular weight of 543.45 g/mol. Its IUPAC name is N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-2-(5-nitrothiophen-2-yl)quinoline-4-carboxamide.
| Compound Name | N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-2-(5-nitrothiophen-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 71592356 |
| Molecular Formula | C21H11BrN4O3S3 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 541.92 |
| IUPAC Name | N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-2-(5-nitrothiophen-2-yl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(Br)s2)cs1)c1cc(-c2ccc([N+](=O)[O-])s2)nc2ccccc12 |
| InChI | InChI=1S/C21H11BrN4O3S3/c22-18-7-5-17(31-18)15-10-30-21(24-15)25-20(27)12-9-14(16-6-8-19(32-16)26(28)29)23-13-4-2-1-3-11(12)13/h1-10H,(H,24,25,27) |
| InChIKey | KDSJRUYAYMIYME-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|