C21H15BrN2O2S — CID 15997152
2-(5-bromothiophen-2-yl)-N-(3-methoxyphenyl)quinoline-4-carboxamide (PubChem CID 15997152) has the molecular formula C21H15BrN2O2S and a molecular weight of 439.33 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-N-(3-methoxyphenyl)quinoline-4-carboxamide.
| Compound Name | 2-(5-bromothiophen-2-yl)-N-(3-methoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 15997152 |
| Molecular Formula | C21H15BrN2O2S |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-N-(3-methoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1cccc(NC(=O)c2cc(-c3ccc(Br)s3)nc3ccccc23)c1 |
| InChI | InChI=1S/C21H15BrN2O2S/c1-26-14-6-4-5-13(11-14)23-21(25)16-12-18(19-9-10-20(22)27-19)24-17-8-3-2-7-15(16)17/h2-12H,1H3,(H,23,25) |
| InChIKey | XEQALXLSAPDBOW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |