C8H4F2N4OS — CID 105381676
2,3-difluoro-N-(thiadiazol-5-yl)pyridine-4-carboxamide (PubChem CID 105381676) has the molecular formula C8H4F2N4OS and a molecular weight of 242.21 g/mol. Its IUPAC name is 2,3-difluoro-N-(thiadiazol-5-yl)pyridine-4-carboxamide.
| Compound Name | 2,3-difluoro-N-(thiadiazol-5-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105381676 |
| Molecular Formula | C8H4F2N4OS |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 2,3-difluoro-N-(thiadiazol-5-yl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1cnns1)c1ccnc(F)c1F |
| InChI | InChI=1S/C8H4F2N4OS/c9-6-4(1-2-11-7(6)10)8(15)13-5-3-12-14-16-5/h1-3H,(H,13,15) |
| InChIKey | COGMVYNMGOURIV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|