About N-(5-amino-1,3,4-thiadiazol-2-yl)thiadiazole-5-carboxamide
N-(5-amino-1,3,4-thiadiazol-2-yl)thiadiazole-5-carboxamide (PubChem CID 79515195) has the molecular formula C5H4N6OS2
and a molecular weight of 228.26 g/mol. Its IUPAC name is N-(5-amino-1,3,4-thiadiazol-2-yl)thiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(5-amino-1,3,4-thiadiazol-2-yl)thiadiazole-5-carboxamide |
| PubChem CID | 79515195 |
| Molecular Formula | C5H4N6OS2 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | N-(5-amino-1,3,4-thiadiazol-2-yl)thiadiazole-5-carboxamide |
| SMILES | Nc1nnc(NC(=O)c2cnns2)s1 |
| InChI | InChI=1S/C5H4N6OS2/c6-4-9-10-5(13-4)8-3(12)2-1-7-11-14-2/h1H,(H2,6,9)(H,8,10,12) |
| InChIKey | ZXOXBHAFOSYRSX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-(5-amino-1,3,4-thiadiazol-2-yl)thiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-1,3,4-thiadiazol-2-yl)thiadiazole-5-carboxamide?
The IUPAC name of N-(5-amino-1,3,4-thiadiazol-2-yl)thiadiazole-5-carboxamide (CID 79515195) is N-(5-amino-1,3,4-thiadiazol-2-yl)thiadiazole-5-carboxamide.
What is the SMILES notation for N-(5-amino-1,3,4-thiadiazol-2-yl)thiadiazole-5-carboxamide?
The canonical SMILES for N-(5-amino-1,3,4-thiadiazol-2-yl)thiadiazole-5-carboxamide is Nc1nnc(NC(=O)c2cnns2)s1.
What is the InChIKey of N-(5-amino-1,3,4-thiadiazol-2-yl)thiadiazole-5-carboxamide?
The InChIKey is ZXOXBHAFOSYRSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N6OS2/c6-4-9-10-5(13-4)8-3(12)2-1-7-11-14-2/h1H,(H2,6,9)(H,8,10,12).
What are the key properties of N-(5-amino-1,3,4-thiadiazol-2-yl)thiadiazole-5-carboxamide?
N-(5-amino-1,3,4-thiadiazol-2-yl)thiadiazole-5-carboxamide has a molecular weight of 228.26 g/mol, XLogP of 0.22, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-1,3,4-thiadiazol-2-yl)thiadiazole-5-carboxamide is sourced from PubChem (CID 79515195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).