C9H7N3O4S — CID 45284591
N-(3-methyl-1,2-oxazol-5-yl)-5-nitrothiophene-2-carboxamide (PubChem CID 45284591) has the molecular formula C9H7N3O4S and a molecular weight of 253.24 g/mol. Its IUPAC name is N-(3-methyl-1,2-oxazol-5-yl)-5-nitrothiophene-2-carboxamide.
| Compound Name | N-(3-methyl-1,2-oxazol-5-yl)-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 45284591 |
| Molecular Formula | C9H7N3O4S |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | N-(3-methyl-1,2-oxazol-5-yl)-5-nitrothiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc([N+](=O)[O-])s2)on1 |
| InChI | InChI=1S/C9H7N3O4S/c1-5-4-7(16-11-5)10-9(13)6-2-3-8(17-6)12(14)15/h2-4H,1H3,(H,10,13) |
| InChIKey | NYTVQUQFHWVZPU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|