C18H14N4O4S3 — CID 3854779
N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1,3-benzothiazol-6-yl]-5-nitrothiophene-2-carboxamide (PubChem CID 3854779) has the molecular formula C18H14N4O4S3 and a molecular weight of 446.54 g/mol. Its IUPAC name is N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1,3-benzothiazol-6-yl]-5-nitrothiophene-2-carboxamide.
| Compound Name | N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1,3-benzothiazol-6-yl]-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3854779 |
| Molecular Formula | C18H14N4O4S3 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | N-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1,3-benzothiazol-6-yl]-5-nitrothiophene-2-carboxamide |
| SMILES | Cc1noc(C)c1CSc1nc2ccc(NC(=O)c3ccc([N+](=O)[O-])s3)cc2s1 |
| InChI | InChI=1S/C18H14N4O4S3/c1-9-12(10(2)26-21-9)8-27-18-20-13-4-3-11(7-15(13)29-18)19-17(23)14-5-6-16(28-14)22(24)25/h3-7H,8H2,1-2H3,(H,19,23) |
| InChIKey | SEMDLGBWUFZMLS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|